Question

10 multiple choice 2 points which of the following condensed formulas represents the same compound as the line - angle structure shown? ch3ch2ch2och2n(ch2ch3)2 ch3ch2ch2och2ch2ch2n(ch2ch2ch3)2 ch3ch2och2n(ch2ch2ch3)2 ch3ch2och2n(ch2ch3)2 ch3on(ch3)2

Explanation:

Step1: Analyze line - angle structure

The line - angle structure has an oxygen - containing ether group and a nitrogen with two ethyl - like substituents. Also, there is a 3 - carbon chain attached to the oxygen on one side.

Step2: Match with condensed formulas

Count the number of carbon atoms and their connectivity in the line - angle structure and compare with the condensed formulas. The correct condensed formula should have a 3 - carbon chain attached to oxygen, an oxygen atom, a CH₂ group attached to oxygen, and a nitrogen with two ethyl groups.

Answer:

A. CH₃CH₂CH₂OCH₂N(CH₂CH₃)₂